| Identification | |
| Name: | 1,4-Cyclohexanedimethanol |
| Synonyms: | 1,4-Bis(hydroxymethyl)cyclohexane;1,4-Cyclohexamethylenebis methylol;1,4-Dimethylolcyclohexane;CHDM;CHDM-D;Cyclohex-1,4-ylenedimethanol;NSC 44508;Rikabinol DM;Sky CHDM;Vibracure A240;1,4-Cyclohexane dimethanol; |
| CAS: | 105-08-8 |
| EINECS: | 203-268-9 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.004 g/cm3 |
| Refractive index: | 1.47 |
| Water Solubility: | miscible |
| Solubility: | soluble |
| Appearance: | white solid |
| Specification: | clear colourless viscous liquid after melting Safety Statements:22-24/25-39-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 39:Wear eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Color: | LIQUID |
| Safety Data | |
 |
|
