| Identification |
| Name: | 1,4-Benzoquinone dioxime |
| Synonyms: | 2,5-Cyclohexadiene-1,4-dione,dioxime (9CI);Benzoquinone dioxime (6CI);p-Benzoquinone, dioxime (8CI);Actor Q;GM-P;NSC 14433;NSC 4774;Quinone dioxime;Vulnoc GM;Vulnoc GM-P;p-Quinone dioxime;p-Quinone oxime;2,5-Cyclohexadiene-1,4-dione,1,4-dioxime; |
| CAS: | 105-11-3 |
| EINECS: | 203-271-5 |
| Molecular Formula: | C6H6N2O2 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C6H6N2O2/c9-7-5-1-2-6(8-10)4-3-5/h1-4,9-10H/b7-5-,8-6- |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | 315 |
| Density: | 1.49 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive index: | 1.594 |
| Water Solubility: | Water Solubility : |
| Solubility: | Water Solubility : <0.01 g/100 mL at 22.5 oC |
| Appearance: | pale yellow to brown crystals or powder |
| Specification: | pale yellow to brown crystals or powder Safety Statements:45-36/37 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | °C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | PALE YELLOW NEEDLES FROM WATER |
| Usage: | Rubber accelerator. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |