| Identification | |
| Name: | Vinyl propionate |
| Synonyms: | Propionic acid vinyl ester |
| CAS: | 105-38-4 |
| EINECS: | 203-293-5 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.11 |
| InChI: | InChI=1/C5H8O2/c1-3-5(6)7-4-2/h4H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3/PG 2 |
| Melting Point: | −80 °C(lit.) |
| Flash Point: | 43 °F |
| Density: | 0.92 |
| Refractive index: | n20/D 1.403(lit.) |
| Specification: | Safety Statements:9-16-26-29-33-36/37 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 29:Do not empty into drains 33:Take precautionary measures against static discharges 36/37:Wear suitable protective clothing and gloves |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 43 °F |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
