| Identification | |
| Name: | Ethyl chloroacetate |
| Synonyms: | Ethyl chloroacetate,(Chloroacetic acid ethyl ester); Chloroacetic acid ethyl ester |
| CAS: | 105-39-5 |
| EINECS: | 203-294-0 |
| Molecular Formula: | C4H7ClO2 |
| Molecular Weight: | 122.55 |
| InChI: | InChI=1/C4H7ClO2/c1-2-7-4(6)3-5/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1181 |
| Density: | 1.145 |
| Stability: | Stable. Incompatible with acids, bases, oxidizing agents, reducing agents. Flammable. |
| Refractive index: | 1.42-1.422 |
| Solubility: | Insol in water; miscible with alc, ether Sol in benzene Insoluble in water, miscible in ethanol, acetone and ethyl ether Miscible in oxygenated solvents |
| Appearance: | Clear liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Water-white mobile liq Liquid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
