| Identification | |
| Name: | 2-Hexanamine, 4-methyl- |
| Synonyms: | NSC 1106;Forthan;Methylhexaneamine;Forthane;Pentylamine,1,3-dimethyl- (6CI,7CI,8CI);1,3-Dimethylamylamine;2-Amino-4-methylhexane;4-Methyl-2-hexylamine; |
| CAS: | 105-41-9 |
| EINECS: | 203-296-1 |
| Molecular Formula: | C7H17N |
| Molecular Weight: | 115.22 |
| InChI: | InChI=1/C7H17N/c1-4-6(2)5-7(3)8/h6-7H,4-5,8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 120-130 oC |
| Density: | 0.775 g/cm3 |
| Water Solubility: | soluble in water |
| Solubility: | soluble in water |
| Appearance: | White or category of white crystal powder |
| Specification: |
?1,3-Dimethylpentylamine(CAS NO.105-41-9) is also called as Methylhexaneamine?; 2-Amino-4-methylhexane ;?4-Methyl-2-hexylamine ;?Forthan ; Forthane ; Methylhexaneamine ;?2-Hexanamine, 4-methyl- (9CI) ; Pentylamine, 1,3-dimethyl- . |
| Usage: | It is useful in compositions, for example as dietary supplements, and for appetite suppression. |
| Safety Data | |
 |
|
