| Identification | |
| Name: | Pentanedioicacid, 3-oxo-, 1,5-diethyl ester |
| Synonyms: | Glutaricacid, 3-oxo-, diethyl ester (6CI,7CI,8CI);Glutaric acid, b-oxo-, diethyl ester (4CI);Pentanedioic acid, 3-oxo-, diethylester (9CI);3-Oxopentanedioic acid diethyl ester;Acetonedicarboxylic aciddiethyl ester;Diethyl2-oxopropane-1,3-dicarboxylate;Diethyl 3-ketoglutarate;Diethyl3-oxoglutarate;Diethyl 3-oxopentanedioate;Diethyl acetonedicarboxylate;Diethyl b-ketoglutarate;Diethyl b-oxoglutarate;NSC 9013;b-Ketoglutaric acid diethyl ester;Diethyl acetone-1,3-dicarboxylate; |
| CAS: | 105-50-0 |
| EINECS: | 203-302-2 |
| Molecular Formula: | C9H14O5 |
| Molecular Weight: | 202.21 |
| InChI: | InChI=1/C9H14O5/c1-3-13-8(11)5-7(10)6-9(12)14-4-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.112 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.438-1.442 |
| Solubility: | 10 g/L (20 oC) |
| Appearance: | Colourless and oily liquid |
| Specification: | clear colorless to pale yellow liquid Safety Statements:23-24/25-36-26 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29183000 |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
