| Identification | |
| Name: | Diethyl malonate |
| Synonyms: | Diethyl propanedioate;Propanedioic acid, diethyl ester;Carbethoxyacetic ester;Dicarbethoxymethane;Methanedicarboxylic acid, diethyl ester;Malonic ester;Malonic acid, diethyl ester;Ethyl Malonate;Propanedioic acid, 1,3-diethyl ester; |
| CAS: | 105-53-3 |
| EINECS: | 203-305-9 |
| Molecular Formula: | C7H12O4 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.055 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, |
| Refractive index: | 1.413-1.415 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | Colorless.. |
| Specification: | colourless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | Z01 |
| HS Code: | 29171910 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Production of barbiturates. |
| Safety Data | |
 |
|
