| Identification | |
| Name: | Ethyl butyrate |
| Synonyms: | Butyric acid ethyl ester; Ethylbutyrat; Ethyl butanoate; ETHYL BUTYRATE ; NATURAL ETHYL BUTYRATE |
| CAS: | 105-54-4 |
| EINECS: | 203-306-4 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1180 |
| Density: | 0.87 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, acids, bases. |
| Refractive index: | 1.391-1.393 |
| Water Solubility: | practically insoluble |
| Solubility: | Water Solubility : practically insoluble |
| Appearance: | colourless liquid with a fruity odour |
| Specification: |
?Ethyl butyrate (CAS No.:105-54-4), also known as ethyl butanoate, or butyric ether, is an ester with the chemical formula CH3CH2CH2COOCH2CH3, with one oxygen having a double bond. It is soluble in propylene glycol, paraffin oil and kerosene. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
