| Identification | |
| Name: | N-Methyldiethanolamine |
| Synonyms: | 2,2-(Methylimino)diethanol; MDEA; 2,2-Methyliminodiethanol; N-Methylediethanolamine; N-METHYL DIETHANOLAMINE; METHYL DIETHANLAMINE |
| CAS: | 105-59-9 |
| EINECS: | 203-312-7 |
| Molecular Formula: | C5H13NO2 |
| Molecular Weight: | 119.16 |
| InChI: | InChI=1/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.038 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4675-1.4695 |
| Water Solubility: | miscible |
| Solubility: | Miscible in Benzene |
| Appearance: | Water-white, hygroscopic liquid with an ammonia odor |
| Specification: | colourless viscous liquid Safety Statements:24 24:Avoid contact with skin |
| Packinggroup: | II |
| Color: | Colorless liquid Liquid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
