| Identification | |
| Name: | 1-Butanol, 3-methyl-,1-propanoate |
| Synonyms: | 1-Butanol,3-methyl-, propanoate (9CI);Isopentyl alcohol, propionate (7CI,8CI);Propionicacid, isopentyl ester (6CI);3-Methyl-1-butanol propanoate;3-Methylbutylpropanoate;3-Methylbutyl propionate;Isoamyl propanoate;Isopentyl propanoate;Isopentyl propionate;NSC 7932;iso-Pentyl propionate; |
| CAS: | 105-68-0 |
| EINECS: | 203-322-1 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-4-8(9)10-6-5-7(2)3/h7H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3/PG 3 |
| Melting Point: | -73 |
| Flash Point: | 118 °F |
| Density: | 0.871 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | n20/D 1.406(lit.) |
| Solubility: | insoluble |
| Appearance: | Clear colorless liquid |
| Specification: | Clear colorless liquid Safety Statements:16-27-36/37/39 16:Keep away from sources of ignition - No smoking 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29155000 |
| Flash Point: | 118 °F |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
