| Identification | |
| Name: | 2-Butenedioic acid(2E)-, 1,4-dibutyl ester |
| Synonyms: | 2-Butenedioicacid (2E)-, dibutyl ester (9CI);2-Butenedioic acid (E)-, dibutyl ester;Fumaric acid, dibutyl ester (6CI,8CI);Butyl fumarate;Fumaric acid di-n-butyl ester;NSC 140;RC Comonomer DBF;Staflex DBF; |
| CAS: | 105-75-9 |
| EINECS: | 203-327-9 |
| Molecular Formula: | C12H20O4 |
| Molecular Weight: | 228.29 |
| InChI: | InChI=1/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -18 °C |
| Flash Point: | 90°C |
| Density: | 0.98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4455-1.4475 |
| Solubility: | Insoluble |
| Appearance: | Clear, almost colorless liquid. |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 90°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
