| Identification | ||
| Name: | Geranyl acetate | |
| Synonyms: | 2,6-Octadien-1-ol, 3, 7-dimethyl-, acetate, trans-;3,7-Dimethyl-2,6-octadien-1-ol acetate;trans-3,7-Dimethyl-2,6-octadien-1-ol, acetate;2,6-Octadien-1-ol, 3, 7-dimethyl-, acetate, (E)-;Acetic acid geraniol ester;Bay pine (oyster) oil;2,6-Octadien-1-ol, 3,7-dimethyl-, acetate,(E)-;Geraniol acetate;3,7-Dimethyl-2-trans, 6-octadienyl acetate;NCI-C54728;Natural Geranyl Acetate;FEMA No. 2509; | |
| CAS: | 105-87-3 | |
| EINECS: | 203-341-5 | |
| Molecular Formula: | C12H20O2 | |
| Molecular Weight: | 196.29 | |
| InChI: | InChI=1/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 0.91 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.461-1.463 | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | <0.1 g/100 mL at 20 ºC in water | |
| Appearance: | Colorless to yellowish liquid. | |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes | |
| Storage Temperature: | 2-8°C | |
| Color: | Clear, colorless liquid | |
| Usage: | Used as synthetic flavoring substance & adjuvant. | |
| Safety Data | ||
| Hazard Symbols |
Xi: Irritant
|
|
 |
||
