Identification |
Name: | Ethanone,1-(4-octylphenyl)- |
Synonyms: | Acetophenone,4'-octyl- (6CI,7CI,8CI);4'-Octylacetophenone;NSC 168987;p-Octylacetophenone; |
CAS: | 10541-56-7 |
Molecular Formula: | C16H24O |
Molecular Weight: | 232.36 |
InChI: | InChI=1/C16H24O/c1-3-4-5-6-7-8-9-15-10-12-16(13-11-15)14(2)17/h10-13H,3-9H2,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 22ºC |
Density: | 0.919 g/cm3 |
Refractive index: | 1.494 |
Water Solubility: | Nonsoluble in water. Soluble in hexane, ethanol and 2-propanol, highly soluble in acetone, toluene, dichloromethane |
Solubility: | Nonsoluble in water. Soluble in hexane, ethanol and 2-propanol, highly soluble in acetone, toluene, dichloromethane |
Appearance: | Low melting colorless to light yellow solid, aromatic odor |
Safety Data |
|
|