| Identification | |
| Name: | Acetamide,N,N'-1,2-ethanediylbis[N-acetyl- |
| Synonyms: | TAED 4303;Warwick B610;Diacetamide,N,N'-ethylenebis- (7CI,8CI);Mykon ATC;N,N,N',N'-Tetraacetylethylenediamine;N,N'-1,2-Ethanediylbis[N-acetylacetamide];N,N'-Ethylenebis[N-acetylacetamide];N,N'-Ethylenebis[diacetamide];Nikon A;Peractive AN;Peractive P;PeractiveTAED;T 0946;TAED;TAED 4049; |
| CAS: | 10543-57-4 |
| EINECS: | 234-123-8 |
| Molecular Formula: | C10H16N2O4 |
| Molecular Weight: | 228.25 |
| InChI: | InChI=1/C10H16N2O4/c1-7(13)11(8(2)14)5-6-12(9(3)15)10(4)16/h5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140 °C (1.5002 mmHg) |
| Boiling Point: | 140 °C (1.5002 mmHg) |
| Density: | 0.9 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.497 |
| Water Solubility: | slightly soluble |
| Solubility: | 140 °C (1.5002 mmHg) |
| Appearance: | Off white to cream crystalline powder. Slight odor. |
| Specification: | off-white to beige granular powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 140 °C (1.5002 mmHg) |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Peroxide bleach activator for household detergents, paper pulp. |
| Safety Data | |
 |
|
