| Identification | |
| Name: | Nitrogen oxide (N2O4) |
| Synonyms: | Dinitrogentetraoxide; Dinitrogen tetroxide; Nitrogen tetraoxide; Nitrogen tetroxide |
| CAS: | 10544-72-6 |
| EINECS: | 234-126-4 |
| Molecular Formula: | N2O4 |
| Molecular Weight: | 92.02 |
| InChI: | InChI=1/N2O4/c3-1(4)2(5)6 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1067 2 |
| Flash Point: | °C |
| Refractive index: | 1.434 |
| Water Solubility: | reacts with water |
| Solubility: | reacts with water |
| Appearance: | Transparent gas |
| Flash Point: | °C |
| Color: | COLORLESS GAS YELLOW LIQUID BELOW 22 DEG C Colorless liquid |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
|
 |
|
