| Identification | |
| Name: | 2-Butyn-1-ol,4-(diethylamino)- |
| Synonyms: | 1-(Diethylamino)-2-butyn-4-ol;1-(N,N-Diethylamino)-4-hydroxy-2-butyne;4-(Diethylamino)-2-butyn-1-ol; |
| CAS: | 10575-25-4 |
| EINECS: | 234-163-6 |
| Molecular Formula: | C8H15NO |
| Molecular Weight: | 141.21 |
| InChI: | InChI=1/C8H15NO/c1-3-9(4-2)7-5-6-8-10/h10H,3-4,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 89.7°C |
| Boiling Point: | 222.4°Cat760mmHg |
| Density: | 0.949g/cm3 |
| Refractive index: | n20/D 1.479(lit.) |
| Appearance: | white solid |
| Specification: | White Solid usageEng:An impurity of Oxybutynin. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 89.7°C |
| Usage: | An impurity of Oxybutynin. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
