| Identification |
| Name: | 2-Furancarbothioicacid, anhydrosulfide with O-ethyl hydrogen carbonodithioate |
| Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-ethyl hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-ethyl ester;AC1MI8JY;LS-51996;O-ethyl furan-2-carbonylsulfanylmethanethioate;105770-00-1 |
| CAS: | 105770-00-1 |
| Molecular Formula: | C8H8 O3 S2 |
| Molecular Weight: | 216.2773 |
| InChI: | InChI=1/C8H8O3S2/c1-2-10-8(12)13-7(9)6-4-3-5-11-6/h3-5H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 133.8°C |
| Boiling Point: | 297.6°C at 760 mmHg |
| Density: | 1.334g/cm3 |
| Refractive index: | 1.592 |
| Flash Point: | 133.8°C |
| Safety Data |
| |
 |
