| Identification |
| Name: | Thiazole,2-chloro-5-(chloromethyl)- |
| Synonyms: | 2-Chloro-5-(chloromethyl)thiazole;2-Chloro-5-chloromethyl-1,3-thiazole;2-Chloro-5-thiazolylmethyl chloride;5-Chloromethyl-2-chloro-1,3-thiazole; |
| CAS: | 105827-91-6 |
| EINECS: | 429-830-5 |
| Molecular Formula: | C4H3Cl2NS |
| Molecular Weight: | 168.04432 |
| InChI: | InChI=1S/C4H3Cl2NS/c5-1-3-2-7-4(6)8-3/h2H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 31 |
| Density: | 1.503g/cm3 |
| Refractive index: | 1.583 |
| Water Solubility: | insoluble in water, soluble in dichloromethane, chloroform, carbon tetrachloride and other solvents |
| Solubility: | insoluble in water, soluble in dichloromethane, chloroform, carbon tetrachloride and other solvents |
| Appearance: | white to pale yellow crystal or colorless liquid |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
