| Identification | |
| Name: | Hexanedioic acid,1,6-dipropyl ester |
| Synonyms: | Adipicacid, dipropyl ester (6CI,7CI,8CI); Hexanedioic acid, dipropyl ester (9CI);Adipic acid di-n-propyl ester; Di-n-propyl adipate; Dipropyl adipate; Dipropylhexanedioate; NSC 4894 |
| CAS: | 106-19-4 |
| EINECS: | 203-371-9 |
| Molecular Formula: | C12H22 O4 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1/C12H22O4/c1-3-9-15-11(13)7-5-6-8-12(14)16-10-4-2/h3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -15.7 |
| Density: | 0.979 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4292 (20 C) |
| Solubility: | Insoluble |
| Appearance: | Liquid. |
| Specification: | Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
