| Identification | |
| Name: | Geraniol |
| Synonyms: | 3,7-Dimethyl-trans-2, 6-octadien-1-ol;2,6-Dimethyl-trans-2, 6-octadien-8-ol;trans-Geraniol;Geraniol alcohol;Guaniol;(E)-3,7-dimethylocta-2,6-dien-1-ol;Lemonol;2,6-Octadien-1-ol,3,7-dimethyl-,(2E)-;Geranyl alcohol;Geraniol extra;trans-3,7-Dimethyl-2,6-octadien-1-ol;Nerol;Geraniol;2,6-Dimethyl-2,6-octadien-8-ol; |
| CAS: | 106-24-1 |
| EINECS: | 203-377-1 |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.28 |
| InChI: | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 76 oC |
| Density: | 0.878 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.475-1.479 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | oily, colorless to light yellow viscous liquid. |
| Specification: | colourless to pale yellow liquid with an odour of roses Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Flash Point: | 76 oC |
| Color: | Colorless to pale-yellow, liquid oil Oily liquid |
| Usage: | In soaps & cosmetics. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
