| Identification | |
| Name: | 2,6-Octadienal,3,7-dimethyl-, (2Z)- |
| Synonyms: | 2,6-Octadienal,3,7-dimethyl-, (Z)- (8CI); (2Z)-3,7-Dimethyl-2,6-octadien-1-al;(2Z)-3,7-Dimethyl-2,6-octadienal; (Z)-3,7-Dimethyl-2,6-octadienal; (Z)-Citral;(Z)-Neral; 2-cis-3,7-Dimethyl-2,6-octadienal; Citral b; Neral;cis-3,7-Dimethyl-2,6-octadienal; cis-Citral; b-Citral |
| CAS: | 106-26-3 |
| EINECS: | 203-379-2 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.2334 |
| InChI: | InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 101.7°C |
| Boiling Point: | 229°Cat760mmHg |
| Density: | 0.856g/cm3 |
| Refractive index: | 1.456 |
| Solubility: | Soluble in 5 volumes of 60% alcohol; soluble in all proportions of benzyl benzoate, diethyl phthalate, glycerin, propylene glycol, mineral oil, fixed oils, and 95% alcohol. Solubility in alcohol: 1 mL in 7 mL 70% alcohol In water, 1.34X10+3 mg/L at 37 deg C |
| Flash Point: | 101.7°C |
| Color: | Mobile pale yellow liquid |
| Safety Data | |
 |
|
