| Identification | |
| Name: | Ethyl heptanoate |
| Synonyms: | Enanthic acid, ethyl ester (4CI);Cognac oil;Enanthylic ether;Ethyl enanthate;Ethyl heptoate;Ethyl heptylate;Ethyl n-heptanoate;Ethyl oenanthate;Ethyl oenanthylate;NSC 8891;Oenanthic ether;Heptanoic acid, ethyl ester; |
| CAS: | 106-30-9 |
| EINECS: | 203-382-9 |
| Molecular Formula: | C9H18O2 |
| Molecular Weight: | 158.24 |
| InChI: | InChI=1/C9H18O2/c1-3-5-6-7-8-9(10)11-4-2/h3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.868 |
| Refractive index: | 1.411-1.413 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid |
| Specification: | clear colorless liquid Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed |
| Usage: | Substance is used in the production of liqueurs. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
