| Identification | |
| Name: | Ethyl caprylate |
| Synonyms: | Ethyl octanoate; Octanoic acid ethyl ester; Ethyl Octylate; n-Caprylic Acid Ethyl Ester; Ethyl Octlate |
| CAS: | 106-32-1 |
| EINECS: | 203-385-5 |
| Molecular Formula: | C10H20O2 |
| Molecular Weight: | 172.27 |
| InChI: | InChI=1/C10H20O2/c1-3-5-6-7-8-9-10(11)12-4-2/h3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.868 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.415-1.42 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | COLORLESS TO PALE YELLOW LIQUID |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Production of fruit ethers. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
