| Identification | |
| Name: | para-Dichlorobenzene |
| Synonyms: | 1,4-Dichlorobenzene; PARA; p-dichlorobenzol; p-chlorophenyl chloride; Paracide; Paradow; Paramoth; paranuggets; Para-zene; Dichlorobenzene, 1,4-Dichlorocide; dichloricide; DCB; Evola; globol; PDB; PDCB; persia-perazol; santochlor; p-Dichloro Benzene; p-dichlorobenzene; |
| CAS: | 106-46-7 |
| EINECS: | 203-400-5 |
| Molecular Formula: | C6H4Cl2 |
| Molecular Weight: | 147 |
| InChI: | InChI=1/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.241 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, aluminium and its alloys, some plastics. |
| Refractive index: | 1.5434 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble SOLVENT |
| Appearance: | white crystal flakes |
| Specification: | colourless or white crystals Safety Statements:36/37-46-60-61-45-16-7 36/37:Wear suitable protective clothing and gloves 46:If swallowed, seek medical advice immediately and show this container or label 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking 7:Keep container tightly closed |
| Packinggroup: | III |
| HS Code: | 29036100 |
| Color: | White crystals Colorless or white crystalline solid ... |
| Usage: | Insecticidal fumigant, popular for domestic use against clothes moths. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
