| Identification | |
| Name: | isobutyl acrylate |
| Synonyms: | Acrylicacid, isobutyl ester (6CI,8CI); Isobutyl 2-propenoate; Isobutyl acrylate; NSC20949 |
| CAS: | 106-63-8 |
| EINECS: | 203-417-8 |
| Molecular Formula: | C7H12O2 |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C7H12O2/c1-4-7(8)9-5-6(2)3/h4,6H,1,5H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2527 |
| Melting Point: | -60ºC |
| Flash Point: | 91? |
| Density: | 0.89 |
| Stability: | Stability Heat and light sensitive. Susceptible to polymerisation. Flammable. Incompatible with strong oxidizing agents, aldehydes. |
| Refractive index: | 1.414 |
| Solubility: | Slightly soluble |
| Appearance: | liquid |
| Specification: | liquid Safety Statements:9-24-37 9:Keep container in a well-ventilated place 24:Avoid contact with skin 37:Wear suitable gloves |
| Packinggroup: | III |
| Flash Point: | 91? |
| Storage Temperature: | The effectiveness of phenolic inhibitors is dependent on the presence of oxygen and the monomers must be stored under air rather than an inert atmosphere. Temperature must be kept low to minimize formation of peroxides and other products. The acrylic esters may be stored in mild or stainless steel, or aluminum. Acrylic acid and derivatives |
| Color: | Clear liquid |
| Usage: | Chemical intermediate for polymers, comonomer in acrylic surface coatings. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
