| Identification | |
| Name: | Hexanoic acid, methylester |
| Synonyms: | Methyl capronate;Methyl hexoate;Methyln-hexanoate;NSC 5023;Pastell M 6; |
| CAS: | 106-70-7 |
| EINECS: | 203-425-1 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-3-4-5-6-7(8)9-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Density: | 0.884 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.4047-1.4067 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | clear almost colorless liquid |
| Specification: | colourless liquid Safety Statements:43-16 43:In case of fire, use ... (indicate in the space the precise type of fire-fighting equipment. If water increases the risk add - Never use water) 16:Keep away from sources of ignition - No smoking |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
