Identification |
Name: | Dimethyl sebacate |
Synonyms: | Decanedioicacid, dimethyl ester (9CI);Sebacic acid, dimethyl ester (6CI,8CI);Dimethyldecane-1,10-dioate;Dimethyl octane-1,8-dicarboxylate;Dimethyldecanedioate;NSC 9415;Decanedioic acid,1,10-dimethyl ester; |
CAS: | 106-79-6 |
EINECS: | 203-431-4 |
Molecular Formula: | C12H22O4 |
Molecular Weight: | 230.3 |
InChI: | InChI=1/C12H22O4/c1-15-11(13)9-7-5-3-4-6-8-10-12(14)16-2/h3-10H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 200kgs |
Density: | 0.988 |
Stability: | Stable. Incompatible with oxidizing agents, bases. Combustible. |
Refractive index: | 1.4355 (28 C) |
Solubility: | Insoluble |
Appearance: | clear liquid |
Specification: | colourless melt or liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Packinggroup: | Z01 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Usage: | Plasticizer. |
Safety Data |
|
|