| Identification | |
| Name: | 1,1,3,3-Tetraethoxy-2-methylpropane |
| Synonyms: | 1,1,3,3-TETRAETHOXY-2-METHYLPROPANE;2-Methyl-1,1,3,3-tetraethoxypropane;Propane,1,1,3,3-tetraethoxy-2-methyl- |
| CAS: | 10602-37-6 |
| EINECS: | 234-225-2 |
| Molecular Formula: | C12H26O4 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C12H26O4/c1-6-13-11(14-7-2)10(5)12(15-8-3)16-9-4/h10-12H,6-9H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 52.1°C |
| Boiling Point: | 273°Cat760mmHg |
| Density: | 0.925g/cm3 |
| Refractive index: | 1.423 |
| Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 52.1°C |
| Safety Data | |
 |
|
