| Identification | |
| Name: | Octanoyl bromide,2-bromo- |
| Synonyms: | 2-Bromooctanoylbromide; |
| CAS: | 106265-08-1 |
| Molecular Formula: | C8H14Br2O |
| Molecular Weight: | 286.00 |
| InChI: | InChI=1/C8H14Br2O/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.55 |
| Refractive index: | 1.503 |
| Water Solubility: | Slightly soluble in water |
| Solubility: | Slightly soluble in water |
| Appearance: | colourless to light yellow oily transparent liquid |
| Specification: |
The 2-Bromooctanoyl bromide with the CAS number 106265-08-1 is also called Octanoyl bromide,2-bromo-. Its molecular formula is C8H14Br2O. This chemical is a kind of organics. It should be stored in dry and cool environment. It is colourless to light yellow oily transparent liquid. The properties of the chemical are: (1)ACD/LogP: 4.04; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 1138; (6)ACD/BCF (pH 7.4): 1138; (7)ACD/KOC (pH 5.5): 5360; (8)ACD/KOC (pH 7.4): 5360; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 17.07Å2; (13)Index of Refraction: 1.503; (14)Molar Refractivity: 54.564 cm3; (15)Molar Volume: 184.449 cm3; (16)Polarizability: 21.631×10-24cm3; (17)Surface Tension: 37.735 dyne/cm; (18)Enthalpy of Vaporization: 49.335 kJ/mol; (19)Vapour Pressure: 0.016 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
