| Identification | |
| Name: | 2-Propylvaleric acid sodium salt |
| Synonyms: | sodium 2-propylpentanoate; sodium valproate; Valproate Sodium |
| CAS: | 1069-66-5 |
| EINECS: | 213-961-8 |
| Molecular Formula: | C8H15NaO2 |
| Molecular Weight: | 166.19 |
| InChI: | InChI=1/C8H16O2.Na/c1-3-5-7(6-4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | REM |
| Flash Point: | STABILITY |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | Soluble SOLVENT |
| Appearance: | white powder |
| Packinggroup: | III |
| Flash Point: | STABILITY |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Antiepileptic; increases levels of GABA in the brain |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
