| Identification | |
| Name: | 3-Pyridinemethanamine,1-oxide |
| Synonyms: | 1-(1-oxidopyridin-3-yl)methanamine;3-Aminomethylpyridine-N-Oxide;C-(1-Oxy-pyridin-3-yl)-methylamine; |
| CAS: | 106940-10-7 |
| Molecular Formula: | C6H8N2O |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C6H8N2O/c7-4-6-2-1-3-8(9)5-6/h1-3,5H,4,7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.18 |
| Refractive index: | 1.567 |
| Specification: |
The 3-Pyridinemethanamine 1-oxide with the cas number 106940-10-7, is also called 1-(1-oxidopyridin-3-yl)methanamine .The product category of this chemial is PYRIDINE.You can buy this product by the following suppliers:(1)DAMING CHANGDA CO.,LTD.; (2)Leap Labchem Co.,Ltd.; (3)DSL Chemicals (Shanghai) Co., Ltd.; (4)Lianyungang Haifeng Chemical Co., Ltd.; (5)CHEMSTEP; (6)Eurolabs Limited. The properties of the 3-Pyridinemethanamine 1-oxide are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 2 ; (3)#Freely Rotating Bonds: 2 ; (4)Polar Surface Area: 27.35 Å2 ; (5)Index of Refraction: 1.567 ; (6)Molar Refractivity: 34.36 cm3 ; (7)Molar Volume: 105.2 cm3 ; (8)Polarizability: 13.62×10-24cm3 ; (9)Surface Tension: 48.8 dyne/cm ; (10)Enthalpy of Vaporization: 59.92 kJ/mol ; (11)Vapour Pressure: 3.41×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
