| Identification | |
| Name: | Cyanoacetamide |
| Synonyms: | 2-cyanoacetamide; Malonamide nitrile; 4,5-Dimethylresorcinol |
| CAS: | 107-91-5 |
| EINECS: | 203-531-8 |
| Molecular Formula: | C3H4N2O |
| Molecular Weight: | 84.08 |
| InChI: | InChI=1/C3H4N2O/c4-2-1-3(5)6/h1H2,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.4 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.43 (20 C) |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | white to light cream crystalline powder |
| Specification: |
?2-Cyanoacetamide , with CAS number of 107-91-5, can be called 2-cyano-acetamid ; 3-Nitrilo-propionamide ; Amid kyseliny kyanoctove ; amidkyselinykyanoctove ; Cyanacetamide ; cyanoiminoaceticacid ; Kyanacetamid ; Malonic acid, monoamide mononitrile ; Propionamide, 3-nitrilo- ; Malonamide nitrile . It is a?white to light cream crystalline powder,? 2-Cyanoacetamide (CAS NO.107-91-5) is commonlu used as the intermediates for medicine, dyes and electroplating solution. |
| Report: |
? Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Do not store in direct sunlight. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Open Periodically |
| Color: | NEEDLES FROM ALCOHOL PLATES (WATER) WHITE POWDER |
| Usage: | In organic syntheses (eg starting material for vitamin b6 synthesis). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
