| Identification | |
| Name: | n-Butyric acid |
| Synonyms: | Butyric acid,99%; Butanoic Acid; Alpha-butanoic acid; Butyric acid; Natural Butyric Acid; BUTYRIC ACID; NATURAL BUTYRIC ACID |
| CAS: | 107-92-6 |
| EINECS: | 203-532-3 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2820 |
| Density: | 0.958 |
| Stability: | Stability Flammable. Incompatible with strong oxidizing agents, aluminium and most other common metals, alkalies, reducing agents. |
| Refractive index: | 1.3965-1.3995 |
| Water Solubility: | MISCIBLE |
| Solubility: | MISCIBLE in water |
| Appearance: | colourless liquid with the extremely unpleasant smell of rancid butter |
| Specification: |
Butyric acid (CAS NO.107-92-6), its Synonyms are 1-Butyric acid ; 1-Propanecarboxylic acid ; Buttersaeure ; Butyrate ; n-Butanoic acid ; n-Butyric acid ; Propylformic acid ; Kyselina maselna . |
| Packinggroup: | III |
| Color: | Oily liquid Colorless liquid |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
