| Identification | |
| CAS: | 107-95-9 |
| EINECS: | 203-536-5 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.09 |
| InChI: | InChI=1/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 201 |
| Density: | 1,437 g/cm3 |
| Stability: | Stable. Keep dry. |
| Water Solubility: | H2O: 1 M at 20 °C, clear, colorless |
| Solubility: | 545 g/L |
| Appearance: | White crystals. Only naturally occurring beta amino acid |
| Specification: | White crystalline powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29224920 |
| Storage Temperature: | Store at RT. |
| Usage: | Rate-limiting precursor of carnosine. |
| Safety Data | |
 |
|
