Identification |
Name: | 2-Amino-5-bromopyridine |
Synonyms: | 5-bromo-2-pyridylamine; 5-Bromopyridin-2-amine; 4-AMINO-5-CHLORO-2,1,3-BENZOTHIODIAZOLE |
CAS: | 1072-97-5 |
EINECS: | 214-019-9 |
Molecular Formula: | C5H5BrN2 |
Molecular Weight: | 173.0106 |
InChI: | InChI=1S/C5H5BrN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
Molecular Structure: |
|
Properties |
Transport: | UN 2811 6 |
Density: | 1.71 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | Insoluble in water |
Solubility: | Insoluble in water |
Appearance: | colorless liquid / off white to light to power |
HS Code: | 29333999 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|