| Identification |
| Name: | 4-Chlorophenylhydrazine hydrochloride |
| Synonyms: | P-CHLOROPHENYLHYDRAZINE HCL; P-Chlorophenyluhydrazinehydrochloride; 4-CHLOROPHENYLHYDRAZINE HCL; 1-(4-CHLOROPHENYL)HYDRAZINE HYDROCHLORIDE; LABOTEST-BB LT01147712; CHLOROPHENYLHYDRAZINE(4-) HCL; 4-CHLORO PHENYL HYDRAZXINE HYDROCHLORIDE; 4-Chlorophenylhydrazine hydrochloride 97%; p-Chlorophenylhydrazine hydrochloride |
| CAS: | 1073-70-7 |
| EINECS: | 214-030-9 |
| Molecular Formula: | C6H7ClN2?HCl;C6H8Cl2N2 |
| Molecular Weight: | 179.05 |
| InChI: | InChI=1/C6H7ClN2.ClH/c7-5-1-3-6(9-8)4-2-5;/h1-4,9H,8H2;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Density: | 1.32g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White to pink powder. |
| Packinggroup: | III |
| HS Code: | 29280090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
