| Identification | |
| Name: | 4-(Methylthio)phenol |
| Synonyms: | Phenol,p-(methylthio)- (6CI,7CI,8CI);Phenol, p-methylmercapto- (4CI);4-(Methylmercapto)phenol;4-(Methylsulfenyl)phenol;4-Hydroxyphenyl methyl sulfide;4-Methylsulfanylphenol;Methyl 4-hydroxyphenylsulfide;NSC 75840;p-(Methylthio)phenol;p-Hydroxyphenyl methyl sulfide;p-Hydroxythioanisole; |
| CAS: | 1073-72-9 |
| EINECS: | 214-031-4 |
| Molecular Formula: | C7H8OS |
| Molecular Weight: | 140.2 |
| InChI: | InChI=1/C7H8OS/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.613 |
| Appearance: | Off-white to light purple crystalline powder |
| Specification: |
? 4-(Methylthio)phenol , with CAS number of 1073-72-9, can be called 4-Methylmercaptophenol ; p-(Methylthio)phenol .?4-(Methylthio)phenol (CAS NO.1073-72-9) is used as three asymmetric organic phosphorus insecticide sulfur C phosphorus intermediates, organic synthesis intermediates. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
