| Identification | |
| Name: | 4-Methyl-2-pentanone |
| Synonyms: | Isobutyl methyl ketone; Isopropylacetone; Methyl isobutyl ketone; MIBK; Hexone; Methyl isobutyl keton; Methyl isobuty ketone |
| CAS: | 108-10-1 |
| EINECS: | 203-550-1 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1245 |
| Density: | 0.7978 |
| Refractive index: | 1.395-1.397 |
| Solubility: | Soluble |
| Appearance: | Clear liquid |
| Specification: | clear liquid Safety Statements:9-16-29-45-36/37-7 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 7:Keep container tightly closed |
| Packinggroup: | II |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
