| Identification | |
| Name: | Malonamide |
| Synonyms: | Malonamide(6CI,8CI);Malondiamide;Malonic acid diamide;Malonic diamide;Malonodiamide;NSC 2134;Propanediamide; |
| CAS: | 108-13-4 |
| EINECS: | 203-553-8 |
| Molecular Formula: | C3H6N2O2 |
| Molecular Weight: | 102.09 |
| InChI: | InChI=1/C3H6N2O2/c4-2(6)1-3(5)7/h1H2,(H2,4,6)(H2,5,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.281 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.491 |
| Solubility: | 180 g/L (20 oC) in water |
| Appearance: | white crystalline powder |
| Specification: |
?Malonamide?with cas registry number of 108-13-4 is stable under normal temperatures and pressures but incompatible with strong oxidizing agents, strong reducing agents, acids, bases. It is also known as AI3-24284 ; Carboxamidoacetamide ; Malondiamide ; Malonic acid diamide ; Malonic diamide ; Malonodiamide ; Malonyldiamide ; NSC 2134 ; Propanediamide .?Malonamide is mainly used as raw material?in organic synthesis. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29241900 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols | |
 |
|
