| Identification | |
| Name: | Diisopropylamine |
| Synonyms: | (N-(1-Methylethyl)-2)propanamine; 2-isopropylamine |
| CAS: | 108-18-9 |
| EINECS: | 203-558-5 |
| Molecular Formula: | C6H15N |
| Molecular Weight: | 101.19 |
| InChI: | InChI=1/C6H15N/c1-5(2)7-6(3)4/h5-7H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1158 |
| Density: | 0.716 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. May react violently with strong acids or oxidizers. Air sensitive. |
| Refractive index: | 1.391-1.393 |
| Solubility: | Slightly soluble |
| Appearance: | colorless liquid, Amine-like odor |
| Specification: | Colorless liquid Safety Statements:16-26-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Storage Temperature: | Store at RT. |
| Color: | Colorless liquid ... |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
