| Identification | |
| Name: | Diisopropyl ether |
| Synonyms: | 2,2'-Oxybispropane; 2-Isopropoxypropane; Diisopropyl oxide; DIPE; Isopropyl Ether; Isopropyl ether,stabilized with 100-200 ppm BHT; |
| CAS: | 108-20-3 |
| EINECS: | 203-560-6 |
| Molecular Formula: | C6H14O |
| Molecular Weight: | 102.17 |
| InChI: | InChI=1/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1159 3/PG 2 |
| Density: | 0.72 |
| Stability: | Stability Extremely flammable. This material is a serious fire and explosion risk. Vapour may travel considerable distances to an ignition source, which need not be an open flame, but may be a hot plate, steam pipe, etc. Vapour may be ignited by the static electricty which can build up when isopropyl ether is being poured from one vessel |
| Refractive index: | 1.367-1.369 |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:9-16-29-33 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 33:Take precautionary measures against static discharges |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless volatile liquid Colorless liquid. Colorless liquid |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
