| Identification | |
| Name: | Isopropyl acetate |
| Synonyms: | Acetic acid isopropyl ester; ISO-PROPYLE ACETATE; Iso-Propyl Acetate; 2-Acetoxypropane |
| CAS: | 108-21-4 |
| EINECS: | 203-561-1 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.13 |
| InChI: | InChI=1/C5H10O2/c1-4(2)7-5(3)6/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1220 |
| Density: | 0.872 |
| Stability: | Stable. Flammable - note low flash point. Incompatible with strong oxidizing agents, strong acids, nitrates, alkali metals. May attack some plastics and rubber. |
| Refractive index: | 1.377 |
| Water Solubility: | 2.90 g/100 mL |
| Solubility: | 2.90 g/100 mL |
| Appearance: | colourless liquid with a fruity odour |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Water-white liquid Colorless liquid. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
