| Identification |
| Name: | 3H-Pyrazol-3-one,2,4-dihydro-5-methyl- |
| Synonyms: | 2-Pyrazolin-5-one,3-methyl- (6CI,7CI,8CI); 2,4-Dihydro-5-methyl-3H-pyrazol-3-one;3-Methyl-1H-4,5-dihydropyrazol-5-one; 3-Methyl-2-pyrazolin-5-one;3-Methyl-5-oxo-2-pyrazoline; 3-Methyl-D2-pyrazol-5-one |
| CAS: | 108-26-9 |
| EINECS: | 203-565-3 |
| Molecular Formula: | C4H6 N2 O |
| Molecular Weight: | 98.1 |
| InChI: | InChI=1/C4H6N2O/c1-3-2-4(7)6-5-3/h2H2,1H3,(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 141.1°C |
| Boiling Point: | 309.7°C at 760 mmHg |
| Density: | 1.33 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.475 |
| Water Solubility: | Ethanol: slightly soluble |
| Solubility: | Ethanol: slightly soluble |
| Appearance: | pale white crystal powder |
| Specification: | Yellowish powder usageEng:3-Methyl-5-pyrazolone is used as intermediate for the manufacture of dyestuffs as well as for agrochemicals. Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 141.1°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | 3-Methyl-5-pyrazolone is used as intermediate for the manufacture of dyestuffs as well as for agrochemicals. |
| Safety Data |
| |
 |