| Identification | |
| Name: | Carbonic acid cyclic propylene ester |
| Synonyms: | Carbonicacid, cyclic propylene ester (8CI);Carbonic acid, propylene ester (6CI);1,2-Propanediol carbonate;1,2-Propanediol cyclic carbonate;1,2-Propanediylcarbonate;1,2-Propylene carbonate;1-Methylethylene carbonate;2-Methyl-1,2-ethylene carbonate;2-Oxo-4-methyl-1,3-dioxolane;4-Methyl-1,3-dioxolan-2-one;4-Methyl-1,3-dioxolane-2-one;4-Methyl-2-oxo-1,3-dioxolane;Arconate 1000;Arconate 5000;Arconate HP;Carbonic acid cyclic 1,2-propylene ester;Carbonic acid cyclic methylethyleneester;Cyclic 1,2-propylene carbonate;Cyclic methylethylene carbonate;Cyclicpropylene carbonate;Jeffsol AG 1555;Jeffsol PC;NSC 11784;NSC 1913;PC-HP;Propylene carbonate;Propylene glycol cyclic carbonate;Texacar PC; |
| CAS: | 108-32-7 |
| EINECS: | 203-572-1 |
| Molecular Formula: | C4H6O3 |
| Molecular Weight: | 102.09 |
| InChI: | InChI=1/C4H6O3/c1-3-2-6-4(5)7-3/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.204 |
| Stability: | Stable. Incompatible with strong oxidizing agents, acids, bases, reducing agents. Protect from contact with moist air or water. |
| Refractive index: | 1.42-1.422 |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 29209010 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. Store protected from moisture. |
| Color: | Colorless liquid |
| Usage: | In co2 recovery. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
