Identification |
Name: | Benzene,1-bromo-3-chloro- |
Synonyms: | 1-Bromo-3-chlorobenzene;1-Chloro-3-bromobenzene;3-Bromo-1-chlorobenzene;3-Bromophenyl chloride;3-Chloro-1-bromobenzene;3-Chlorobromobenzene;3-Chlorophenyl bromide;NSC 53548;m-Bromochlorobenzene;m-Bromophenyl chloride;m-Chlorobromobenzene; |
CAS: | 108-37-2 |
EINECS: | 203-575-8 |
Molecular Formula: | C6H4BrCl |
Molecular Weight: | 191.45 |
InChI: | InChI=1/C6H4BrCl/c7-5-2-1-3-6(8)4-5/h1-4H |
Molecular Structure: |
 |
Properties |
Density: | 1.63 |
Refractive index: | 1.576-1.578 |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | Clear colourless to light yellow liquid |
Specification: | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |