| Identification | |
| Name: | m-Toluidine |
| Synonyms: | 3-Aminotoluene; 3-Methylaniline; 3-Methylbenzenamine; 3-Toluidine; m-Toluamine; m-Tolylamine; Meta Toluidine; MT |
| CAS: | 108-44-1 |
| EINECS: | 203-583-1 |
| Molecular Formula: | C7H9N |
| Molecular Weight: | 107.15 |
| InChI: | InChI=1/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1708 |
| Density: | 0.989 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.566-1.568 |
| Solubility: | 0.2 g/100 mL (20 oC) in water |
| Appearance: | Colorless oily liquid |
| Specification: | clear yellow liquid which darkens on standing Safety Statements:53-28-36/37-45-61-28A 53:Avoid exposure - obtain special instruction before use 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | II |
| HS Code: | 29171990 |
| Storage Temperature: | Refrigerator |
| Color: | Colorless liquid Colorless to light yellow liquid. |
| Usage: | Acidulant in processed foods. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
