| Identification | |
| Name: | Glutaric anhydride |
| Synonyms: | Tetrahydropyran-2,6-dione; Dihydro-2H-pyran-2,6(3H)-dione; 1,5-Glutaric anhydride |
| CAS: | 108-55-4 |
| EINECS: | 203-593-6 |
| Molecular Formula: | C5H6O3 |
| Molecular Weight: | 114.1 |
| InChI: | InChI=1/C5H6O3/c6-4-2-1-3-5(7)8-4/h1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.24 |
| Stability: | May decompose on exposure to moist air or water. |
| Refractive index: | 1.463 |
| Water Solubility: | hydrolysis |
| Solubility: | Soluble |
| Appearance: | Beige to light brown crystalline powder |
| Specification: |
Glutaric anhydride , its cas register number is 108-55-4. It also can be called Dihydro-2H-pyran-2,6(3H)-dione ; and 2H-Pyran-2,6(3H)-dione, dihydro- . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29171990 |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
