| Identification | |
| Name: | 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane |
| Synonyms: | Metaldehyde,97%; Metaldehyde; Acetaldehyde tetramer; Metacetaldehyde |
| CAS: | 108-62-3 |
| EINECS: | 203-600-2 |
| Molecular Formula: | C8H16O4 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C8H16O4/c1-5-9-6(2)11-8(4)12-7(3)10-5/h5-8H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1332 |
| Melting Point: | 246 °C |
| Boiling Point: | 194.3°Cat760mmHg |
| Density: | 1.27 |
| Stability: | No data. |
| Refractive index: | 1.385 |
| Solubility: | 0.02 g/100 mL (20 oC) |
| Appearance: | white fine crystalline powder |
| Specification: | white fine crystalline powder Safety Statements:13-25-46 13:Keep away from food, drink and animal feeding stuffs 25:Avoid contact with eyes 46:If swallowed, seek medical advice immediately and show this container or label |
| Packinggroup: | III |
| Color: | Crystalline powder Crystals |
| Usage: | Molluscicide. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
