| Identification | |
| Name: | Mesitylene |
| Synonyms: | 1,3,5-trimethylbenzene single component; 1,3,5-trimethylbenzene neat*standard for epa; 1,3,5-Trimethylbenzene |
| CAS: | 108-67-8 |
| EINECS: | 203-604-4 |
| Molecular Formula: | C9H12 |
| Molecular Weight: | 120.19 |
| InChI: | InChI=1/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2325 |
| Density: | 0.864 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.498-1.5 |
| Appearance: | colorless liquid with a peculiar odor |
| Specification: |
?Mesitylene , its cas register number is 108-67-8. It also can be called?1,3,5-Trimethylbenzene ; 3,5-Dimethyltoluene ; Benzene, 1,3,5-trimethyl- ; Fleet-X ; Trimethylbenzol ; sym-Trimethylbenzene .It is a colorless liquid with a peculiar odor. It insoluble in water and less dense than water. It may be toxic by ingestion and inhalation. |
| Packinggroup: | III |
| HS Code: | 29029080 |
| Color: | Clear, colorless liquid |
| Usage: | Dyestuff intermediate, solvent, paintermediate thinner. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
 |
|
