| Identification | ||
| Name: | 3,5-Dimethylaniline | |
| Synonyms: | 3,5-Xylidine; 3,5-Diemthylaniline; 1-Amino-3,5-dimethylbenzene; 5-Amino-m-xylene | |
| CAS: | 108-69-0 | |
| EINECS: | 203-607-0 | |
| Molecular Formula: | C8H11N | |
| Molecular Weight: | 121.18 | |
| InChI: | InChI=1/C8H11N/c1-6-3-7(2)5-8(9)4-6/h3-5H,9H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 1711 | |
| Density: | 0.972 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.556-1.558 | |
| Water Solubility: | <0.1 g/100 mL at 19 ºC | |
| Solubility: | <0.1 g/100 mL at 19 ºC | |
| Appearance: | Dark brown liquid. | |
| Specification: | clear yellow-brown to brown liquid Safety Statements:28-36/37-45-61-28A 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet | |
| Packinggroup: | II | |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | Oily liquid | |
| Usage: | Used as a chemical intermediate for the synthesis of pigment red 149. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
|
 |
||
